C16H25NO7 — CID 71159621
(1R,4R)-N-[2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 71159621) has the molecular formula C16H25NO7 and a molecular weight of 343.38 g/mol. Its IUPAC name is (1R,4R)-N-[2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | (1R,4R)-N-[2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 71159621 |
| Molecular Formula | C16H25NO7 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | (1R,4R)-N-[2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | O=C(NCCOC1OC(CO)C(O)C(O)C1O)C1C[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C16H25NO7/c18-7-11-12(19)13(20)14(21)16(24-11)23-4-3-17-15(22)10-6-8-1-2-9(10)5-8/h1-2,8-14,16,18-21H,3-7H2,(H,17,22)/t8-,9+,10?,11?,12?,13?,14?,16?/m1/s1 |
| InChIKey | IGUNGNBAYNNYQS-UONVVCLSSA-N |
| XLogP | -1.87 |
| TPSA | 128.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|