C20H23NO5S — CID 101156493
[(4R)-4-benzyl-2-oxo-3-[(1R)-1-phenylethyl]-1,3-oxazolidin-4-yl]methyl methanesulfonate (PubChem CID 101156493) has the molecular formula C20H23NO5S and a molecular weight of 389.47 g/mol. Its IUPAC name is [(4R)-4-benzyl-2-oxo-3-[(1R)-1-phenylethyl]-1,3-oxazolidin-4-yl]methyl methanesulfonate.
| Compound Name | [(4R)-4-benzyl-2-oxo-3-[(1R)-1-phenylethyl]-1,3-oxazolidin-4-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 101156493 |
| Molecular Formula | C20H23NO5S |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | [(4R)-4-benzyl-2-oxo-3-[(1R)-1-phenylethyl]-1,3-oxazolidin-4-yl]methyl methanesulfonate |
| SMILES | C[C@H](c1ccccc1)N1C(=O)OC[C@@]1(COS(C)(=O)=O)Cc1ccccc1 |
| InChI | InChI=1S/C20H23NO5S/c1-16(18-11-7-4-8-12-18)21-19(22)25-14-20(21,15-26-27(2,23)24)13-17-9-5-3-6-10-17/h3-12,16H,13-15H2,1-2H3/t16-,20-/m1/s1 |
| InChIKey | HTVMZCRUCCVKOL-OXQOHEQNSA-N |
| XLogP | 3.16 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|