C14H26O5Si2 — CID 101156918
methyl (1S,6S)-5-oxo-1,6-bis(trimethylsilyloxy)cyclohex-3-ene-1-carboxylate (PubChem CID 101156918) has the molecular formula C14H26O5Si2 and a molecular weight of 330.53 g/mol. Its IUPAC name is methyl (1S,6S)-5-oxo-1,6-bis(trimethylsilyloxy)cyclohex-3-ene-1-carboxylate.
| Compound Name | methyl (1S,6S)-5-oxo-1,6-bis(trimethylsilyloxy)cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 101156918 |
| Molecular Formula | C14H26O5Si2 |
| Molecular Weight | 330.53 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | methyl (1S,6S)-5-oxo-1,6-bis(trimethylsilyloxy)cyclohex-3-ene-1-carboxylate |
| SMILES | COC(=O)[C@]1(O[Si](C)(C)C)CC=CC(=O)[C@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C14H26O5Si2/c1-17-13(16)14(19-21(5,6)7)10-8-9-11(15)12(14)18-20(2,3)4/h8-9,12H,10H2,1-7H3/t12-,14+/m1/s1 |
| InChIKey | PDWRKMZAWYRSJH-OCCSQVGLSA-N |
| XLogP | 2.50 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.53 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|