C24H48O4Si3 — CID 71482460
(4S,5S,6S)-6-prop-2-enyl-4,5-bis(triethylsilyloxy)-6-trimethylsilyloxycyclohex-2-en-1-one (PubChem CID 71482460) has the molecular formula C24H48O4Si3 and a molecular weight of 484.90 g/mol. Its IUPAC name is (4S,5S,6S)-6-prop-2-enyl-4,5-bis(triethylsilyloxy)-6-trimethylsilyloxycyclohex-2-en-1-one.
| Compound Name | (4S,5S,6S)-6-prop-2-enyl-4,5-bis(triethylsilyloxy)-6-trimethylsilyloxycyclohex-2-en-1-one |
|---|---|
| PubChem CID | 71482460 |
| Molecular Formula | C24H48O4Si3 |
| Molecular Weight | 484.90 g/mol |
| Exact Mass | 484.29 |
| IUPAC Name | (4S,5S,6S)-6-prop-2-enyl-4,5-bis(triethylsilyloxy)-6-trimethylsilyloxycyclohex-2-en-1-one |
| SMILES | C=CC[C@@]1(O[Si](C)(C)C)C(=O)C=C[C@H](O[Si](CC)(CC)CC)[C@@H]1O[Si](CC)(CC)CC |
| InChI | InChI=1S/C24H48O4Si3/c1-11-20-24(28-29(8,9)10)22(25)19-18-21(26-30(12-2,13-3)14-4)23(24)27-31(15-5,16-6)17-7/h11,18-19,21,23H,1,12-17,20H2,2-10H3/t21-,23-,24+/m0/s1 |
| InChIKey | VRIJIICJEXTINA-OEMFJLHTSA-N |
| XLogP | 7.07 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.90 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|