C13H24O4Si — CID 11973981
(4S,5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-4,6-dihydroxy-6-methylcyclohex-2-en-1-one (PubChem CID 11973981) has the molecular formula C13H24O4Si and a molecular weight of 272.42 g/mol. Its IUPAC name is (4S,5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-4,6-dihydroxy-6-methylcyclohex-2-en-1-one.
| Compound Name | (4S,5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-4,6-dihydroxy-6-methylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 11973981 |
| Molecular Formula | C13H24O4Si |
| Molecular Weight | 272.42 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | (4S,5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-4,6-dihydroxy-6-methylcyclohex-2-en-1-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)C=CC(=O)[C@@]1(C)O |
| InChI | InChI=1S/C13H24O4Si/c1-12(2,3)18(5,6)17-11-9(14)7-8-10(15)13(11,4)16/h7-9,11,14,16H,1-6H3/t9-,11-,13+/m0/s1 |
| InChIKey | OLRFGEFDVGJCJR-XHVZSJERSA-N |
| XLogP | 1.63 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.42 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|