C27H56O5Si3 — CID 66575423
(E,4S,5R,6S)-4,5,6-tris[[tert-butyl(dimethyl)silyl]oxy]-2-methyl-7-oxooct-2-enal (PubChem CID 66575423) has the molecular formula C27H56O5Si3 and a molecular weight of 545.00 g/mol. Its IUPAC name is (E,4S,5R,6S)-4,5,6-tris[[tert-butyl(dimethyl)silyl]oxy]-2-methyl-7-oxooct-2-enal.
| Compound Name | (E,4S,5R,6S)-4,5,6-tris[[tert-butyl(dimethyl)silyl]oxy]-2-methyl-7-oxooct-2-enal |
|---|---|
| PubChem CID | 66575423 |
| Molecular Formula | C27H56O5Si3 |
| Molecular Weight | 545.00 g/mol |
| Exact Mass | 544.34 |
| IUPAC Name | (E,4S,5R,6S)-4,5,6-tris[[tert-butyl(dimethyl)silyl]oxy]-2-methyl-7-oxooct-2-enal |
| SMILES | CC(=O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](/C=C(\C)C=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H56O5Si3/c1-20(19-28)18-22(30-33(12,13)25(3,4)5)24(32-35(16,17)27(9,10)11)23(21(2)29)31-34(14,15)26(6,7)8/h18-19,22-24H,1-17H3/b20-18+/t22-,23+,24+/m0/s1 |
| InChIKey | LDHAVYTWVRSRAB-YSDWTVKESA-N |
| XLogP | 7.89 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.00 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|