C18H36O4Si3 — CID 71482458
(4S,5S,6S)-6-prop-2-enyl-4,5,6-tris(trimethylsilyloxy)cyclohex-2-en-1-one (PubChem CID 71482458) has the molecular formula C18H36O4Si3 and a molecular weight of 400.74 g/mol. Its IUPAC name is (4S,5S,6S)-6-prop-2-enyl-4,5,6-tris(trimethylsilyloxy)cyclohex-2-en-1-one.
| Compound Name | (4S,5S,6S)-6-prop-2-enyl-4,5,6-tris(trimethylsilyloxy)cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 71482458 |
| Molecular Formula | C18H36O4Si3 |
| Molecular Weight | 400.74 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | (4S,5S,6S)-6-prop-2-enyl-4,5,6-tris(trimethylsilyloxy)cyclohex-2-en-1-one |
| SMILES | C=CC[C@@]1(O[Si](C)(C)C)C(=O)C=C[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C18H36O4Si3/c1-11-14-18(22-25(8,9)10)16(19)13-12-15(20-23(2,3)4)17(18)21-24(5,6)7/h11-13,15,17H,1,14H2,2-10H3/t15-,17-,18+/m0/s1 |
| InChIKey | PLYAWZQCHIAUEV-RYQLBKOJSA-N |
| XLogP | 4.73 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.74 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|