C19H36O6SSi2 — CID 71482457
[(1R,2S,6S)-2-[tert-butyl(dimethyl)silyl]oxy-5-oxo-6-prop-2-enyl-6-trimethylsilyloxycyclohex-3-en-1-yl] methanesulfonate (PubChem CID 71482457) has the molecular formula C19H36O6SSi2 and a molecular weight of 448.73 g/mol. Its IUPAC name is [(1R,2S,6S)-2-[tert-butyl(dimethyl)silyl]oxy-5-oxo-6-prop-2-enyl-6-trimethylsilyloxycyclohex-3-en-1-yl] methanesulfonate.
| Compound Name | [(1R,2S,6S)-2-[tert-butyl(dimethyl)silyl]oxy-5-oxo-6-prop-2-enyl-6-trimethylsilyloxycyclohex-3-en-1-yl] methanesulfonate |
|---|---|
| PubChem CID | 71482457 |
| Molecular Formula | C19H36O6SSi2 |
| Molecular Weight | 448.73 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | [(1R,2S,6S)-2-[tert-butyl(dimethyl)silyl]oxy-5-oxo-6-prop-2-enyl-6-trimethylsilyloxycyclohex-3-en-1-yl] methanesulfonate |
| SMILES | C=CC[C@@]1(O[Si](C)(C)C)C(=O)C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1OS(C)(=O)=O |
| InChI | InChI=1S/C19H36O6SSi2/c1-11-14-19(25-27(6,7)8)16(20)13-12-15(17(19)23-26(5,21)22)24-28(9,10)18(2,3)4/h11-13,15,17H,1,14H2,2-10H3/t15-,17+,19+/m0/s1 |
| InChIKey | MKBCRCBHKLPBMJ-KVSKMBFKSA-N |
| XLogP | 4.03 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.73 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|