C40H66O4Si4 — CID 101157188
[3-[4-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]buta-1,3-diynyl]-5-[tert-butyl(dimethyl)silyl]oxyphenoxy]-tert-butyl-dimethylsilane (PubChem CID 101157188) has the molecular formula C40H66O4Si4 and a molecular weight of 723.31 g/mol. Its IUPAC name is [3-[4-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]buta-1,3-diynyl]-5-[tert-butyl(dimethyl)silyl]oxyphenoxy]-tert-butyl-dimethylsilane.
| Compound Name | [3-[4-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]buta-1,3-diynyl]-5-[tert-butyl(dimethyl)silyl]oxyphenoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 101157188 |
| Molecular Formula | C40H66O4Si4 |
| Molecular Weight | 723.31 g/mol |
| Exact Mass | 722.40 |
| IUPAC Name | [3-[4-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]buta-1,3-diynyl]-5-[tert-butyl(dimethyl)silyl]oxyphenoxy]-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)Oc1cc(C#CC#Cc2cc(O[Si](C)(C)C(C)(C)C)cc(O[Si](C)(C)C(C)(C)C)c2)cc(O[Si](C)(C)C(C)(C)C)c1 |
| InChI | InChI=1S/C40H66O4Si4/c1-37(2,3)45(13,14)41-33-25-31(26-34(29-33)42-46(15,16)38(4,5)6)23-21-22-24-32-27-35(43-47(17,18)39(7,8)9)30-36(28-32)44-48(19,20)40(10,11)12/h25-30H,1-20H3 |
| InChIKey | XGXZEZUUODMXEF-UHFFFAOYSA-N |
| XLogP | 12.63 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.31 |
| LogP ≤ 5 | 12.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|