C11H18O4 — CID 101157400
6-hydroxy-2,2-dimethyl-5-pent-4-enyl-1,3-dioxan-4-one (PubChem CID 101157400) has the molecular formula C11H18O4 and a molecular weight of 214.26 g/mol. Its IUPAC name is 6-hydroxy-2,2-dimethyl-5-pent-4-enyl-1,3-dioxan-4-one.
| Compound Name | 6-hydroxy-2,2-dimethyl-5-pent-4-enyl-1,3-dioxan-4-one |
|---|---|
| PubChem CID | 101157400 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 6-hydroxy-2,2-dimethyl-5-pent-4-enyl-1,3-dioxan-4-one |
| SMILES | C=CCCCC1C(=O)OC(C)(C)OC1O |
| InChI | InChI=1S/C11H18O4/c1-4-5-6-7-8-9(12)14-11(2,3)15-10(8)13/h4,8-9,12H,1,5-7H2,2-3H3 |
| InChIKey | QLHXAXOLPJKPBS-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|