C12H20O4 — CID 58795462
methyl (2S)-2-[(4R,5S)-2,5-dimethyl-1,3-dioxan-4-yl]pent-4-enoate (PubChem CID 58795462) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is methyl (2S)-2-[(4R,5S)-2,5-dimethyl-1,3-dioxan-4-yl]pent-4-enoate.
| Compound Name | methyl (2S)-2-[(4R,5S)-2,5-dimethyl-1,3-dioxan-4-yl]pent-4-enoate |
|---|---|
| PubChem CID | 58795462 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | methyl (2S)-2-[(4R,5S)-2,5-dimethyl-1,3-dioxan-4-yl]pent-4-enoate |
| SMILES | C=CC[C@H](C(=O)OC)[C@@H]1OC(C)OC[C@@H]1C |
| InChI | InChI=1S/C12H20O4/c1-5-6-10(12(13)14-4)11-8(2)7-15-9(3)16-11/h5,8-11H,1,6-7H2,2-4H3/t8-,9?,10-,11+/m0/s1 |
| InChIKey | WKIPXJMPBRYFKE-OFLUOSHYSA-N |
| XLogP | 1.75 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|