C23H23NO4S — CID 101158790
[2-[(4-methylphenyl)sulfonylamino]-1-naphthalen-2-ylethyl] (E)-but-2-enoate (PubChem CID 101158790) has the molecular formula C23H23NO4S and a molecular weight of 409.51 g/mol. Its IUPAC name is [2-[(4-methylphenyl)sulfonylamino]-1-naphthalen-2-ylethyl] (E)-but-2-enoate.
| Compound Name | [2-[(4-methylphenyl)sulfonylamino]-1-naphthalen-2-ylethyl] (E)-but-2-enoate |
|---|---|
| PubChem CID | 101158790 |
| Molecular Formula | C23H23NO4S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | [2-[(4-methylphenyl)sulfonylamino]-1-naphthalen-2-ylethyl] (E)-but-2-enoate |
| SMILES | C/C=C/C(=O)OC(CNS(=O)(=O)c1ccc(C)cc1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C23H23NO4S/c1-3-6-23(25)28-22(20-12-11-18-7-4-5-8-19(18)15-20)16-24-29(26,27)21-13-9-17(2)10-14-21/h3-15,22,24H,16H2,1-2H3/b6-3+ |
| InChIKey | LXKOXIGSHAVVJU-ZZXKWVIFSA-N |
| XLogP | 4.29 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|