About hex-5-ynyl 2-[(E)-2-iodoethenyl]benzoate
hex-5-ynyl 2-[(E)-2-iodoethenyl]benzoate (PubChem CID 101159319) has the molecular formula C15H15IO2
and a molecular weight of 354.19 g/mol. Its IUPAC name is hex-5-ynyl 2-[(E)-2-iodoethenyl]benzoate.
Molecular Properties
| Compound Name | hex-5-ynyl 2-[(E)-2-iodoethenyl]benzoate |
| PubChem CID | 101159319 |
| Molecular Formula | C15H15IO2 |
| Molecular Weight | 354.19 g/mol |
| Exact Mass | 354.01 |
| IUPAC Name | hex-5-ynyl 2-[(E)-2-iodoethenyl]benzoate |
| SMILES | C#CCCCCOC(=O)c1ccccc1/C=C/I |
| InChI | InChI=1S/C15H15IO2/c1-2-3-4-7-12-18-15(17)14-9-6-5-8-13(14)10-11-16/h1,5-6,8-11H,3-4,7,12H2/b11-10+ |
| InChIKey | JXMJZAOWQMNRMZ-ZHACJKMWSA-N |
| XLogP | 4.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.19 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze hex-5-ynyl 2-[(E)-2-iodoethenyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hex-5-ynyl 2-[(E)-2-iodoethenyl]benzoate?
The IUPAC name of hex-5-ynyl 2-[(E)-2-iodoethenyl]benzoate (CID 101159319) is hex-5-ynyl 2-[(E)-2-iodoethenyl]benzoate.
What is the SMILES notation for hex-5-ynyl 2-[(E)-2-iodoethenyl]benzoate?
The canonical SMILES for hex-5-ynyl 2-[(E)-2-iodoethenyl]benzoate is C#CCCCCOC(=O)c1ccccc1/C=C/I.
What is the InChIKey of hex-5-ynyl 2-[(E)-2-iodoethenyl]benzoate?
The InChIKey is JXMJZAOWQMNRMZ-ZHACJKMWSA-N. The full InChI is InChI=1S/C15H15IO2/c1-2-3-4-7-12-18-15(17)14-9-6-5-8-13(14)10-11-16/h1,5-6,8-11H,3-4,7,12H2/b11-10+.
What are the key properties of hex-5-ynyl 2-[(E)-2-iodoethenyl]benzoate?
hex-5-ynyl 2-[(E)-2-iodoethenyl]benzoate has a molecular weight of 354.19 g/mol, XLogP of 4.05, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hex-5-ynyl 2-[(E)-2-iodoethenyl]benzoate is sourced from PubChem (CID 101159319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).