C25H23N3O2 — CID 101161422
(5aR,8aS)-7,9-diphenyl-5-propyl-8a,9-dihydro-5aH-pyrrolo[3,4-b][1,5]naphthyridine-6,8-dione (PubChem CID 101161422) has the molecular formula C25H23N3O2 and a molecular weight of 397.48 g/mol. Its IUPAC name is (5aR,8aS)-7,9-diphenyl-5-propyl-8a,9-dihydro-5aH-pyrrolo[3,4-b][1,5]naphthyridine-6,8-dione.
| Compound Name | (5aR,8aS)-7,9-diphenyl-5-propyl-8a,9-dihydro-5aH-pyrrolo[3,4-b][1,5]naphthyridine-6,8-dione |
|---|---|
| PubChem CID | 101161422 |
| Molecular Formula | C25H23N3O2 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | (5aR,8aS)-7,9-diphenyl-5-propyl-8a,9-dihydro-5aH-pyrrolo[3,4-b][1,5]naphthyridine-6,8-dione |
| SMILES | CCCN1c2cccnc2C(c2ccccc2)[C@@H]2C(=O)N(c3ccccc3)C(=O)[C@@H]21 |
| InChI | InChI=1S/C25H23N3O2/c1-2-16-27-19-14-9-15-26-22(19)20(17-10-5-3-6-11-17)21-23(27)25(30)28(24(21)29)18-12-7-4-8-13-18/h3-15,20-21,23H,2,16H2,1H3/t20?,21-,23+/m0/s1 |
| InChIKey | XTJAEEIBVHVQEN-CBWCPMJDSA-N |
| XLogP | 4.00 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|