C19H19N3O2 — CID 15307121
(5aR,8aS)-7-phenyl-5-propyl-8a,9-dihydro-5aH-pyrrolo[3,4-b][1,5]naphthyridine-6,8-dione (PubChem CID 15307121) has the molecular formula C19H19N3O2 and a molecular weight of 321.38 g/mol. Its IUPAC name is (5aR,8aS)-7-phenyl-5-propyl-8a,9-dihydro-5aH-pyrrolo[3,4-b][1,5]naphthyridine-6,8-dione.
| Compound Name | (5aR,8aS)-7-phenyl-5-propyl-8a,9-dihydro-5aH-pyrrolo[3,4-b][1,5]naphthyridine-6,8-dione |
|---|---|
| PubChem CID | 15307121 |
| Molecular Formula | C19H19N3O2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | (5aR,8aS)-7-phenyl-5-propyl-8a,9-dihydro-5aH-pyrrolo[3,4-b][1,5]naphthyridine-6,8-dione |
| SMILES | CCCN1c2cccnc2C[C@@H]2C(=O)N(c3ccccc3)C(=O)[C@@H]21 |
| InChI | InChI=1S/C19H19N3O2/c1-2-11-21-16-9-6-10-20-15(16)12-14-17(21)19(24)22(18(14)23)13-7-4-3-5-8-13/h3-10,14,17H,2,11-12H2,1H3/t14-,17+/m0/s1 |
| InChIKey | NINLNRBLBUXSTM-WMLDXEAASA-N |
| XLogP | 2.41 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|