C15H18O3 — CID 101161691
(4aS,7aS)-4a-phenylmethoxy-2,3,4,5,7,7a-hexahydrocyclopenta[b]pyran-6-one (PubChem CID 101161691) has the molecular formula C15H18O3 and a molecular weight of 246.31 g/mol. Its IUPAC name is (4aS,7aS)-4a-phenylmethoxy-2,3,4,5,7,7a-hexahydrocyclopenta[b]pyran-6-one.
| Compound Name | (4aS,7aS)-4a-phenylmethoxy-2,3,4,5,7,7a-hexahydrocyclopenta[b]pyran-6-one |
|---|---|
| PubChem CID | 101161691 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | (4aS,7aS)-4a-phenylmethoxy-2,3,4,5,7,7a-hexahydrocyclopenta[b]pyran-6-one |
| SMILES | O=C1C[C@@H]2OCCC[C@]2(OCc2ccccc2)C1 |
| InChI | InChI=1S/C15H18O3/c16-13-9-14-15(10-13,7-4-8-17-14)18-11-12-5-2-1-3-6-12/h1-3,5-6,14H,4,7-11H2/t14-,15-/m0/s1 |
| InChIKey | KQJJKSZHPZINPL-GJZGRUSLSA-N |
| XLogP | 2.48 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |