C32H34N2O5 — CID 101164918
methyl 2-[benzyl(phenylmethoxycarbonyl)amino]-3-[(3S)-3-(3-methylbut-2-enyl)-2-oxo-1H-indol-3-yl]propanoate (PubChem CID 101164918) has the molecular formula C32H34N2O5 and a molecular weight of 526.63 g/mol. Its IUPAC name is methyl 2-[benzyl(phenylmethoxycarbonyl)amino]-3-[(3S)-3-(3-methylbut-2-enyl)-2-oxo-1H-indol-3-yl]propanoate.
| Compound Name | methyl 2-[benzyl(phenylmethoxycarbonyl)amino]-3-[(3S)-3-(3-methylbut-2-enyl)-2-oxo-1H-indol-3-yl]propanoate |
|---|---|
| PubChem CID | 101164918 |
| Molecular Formula | C32H34N2O5 |
| Molecular Weight | 526.63 g/mol |
| Exact Mass | 526.25 |
| IUPAC Name | methyl 2-[benzyl(phenylmethoxycarbonyl)amino]-3-[(3S)-3-(3-methylbut-2-enyl)-2-oxo-1H-indol-3-yl]propanoate |
| SMILES | COC(=O)C(C[C@]1(CC=C(C)C)C(=O)Nc2ccccc21)N(Cc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C32H34N2O5/c1-23(2)18-19-32(26-16-10-11-17-27(26)33-30(32)36)20-28(29(35)38-3)34(21-24-12-6-4-7-13-24)31(37)39-22-25-14-8-5-9-15-25/h4-18,28H,19-22H2,1-3H3,(H,33,36)/t28?,32-/m0/s1 |
| InChIKey | RWXVVTAKEWLFMD-YYMSGCCCSA-N |
| XLogP | 6.00 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.63 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|