C28H26N4O4S — CID 101165344
18-O-methyl 19-O-(2-sulfanylidene-1-pyridinyl) (1S,9S,16R,21S)-21-cyano-2,12-diazahexacyclo[14.2.2.19,12.01,9.03,8.016,21]henicosa-3,5,7,17-tetraene-18,19-dicarboxylate (PubChem CID 101165344) has the molecular formula C28H26N4O4S and a molecular weight of 514.61 g/mol. Its IUPAC name is 18-O-methyl 19-O-(2-sulfanylidene-1-pyridinyl) (1S,9S,16R,21S)-21-cyano-2,12-diazahexacyclo[14.2.2.19,12.01,9.03,8.016,21]henicosa-3,5,7,17-tetraene-18,19-dicarboxylate.
| Compound Name | 18-O-methyl 19-O-(2-sulfanylidene-1-pyridinyl) (1S,9S,16R,21S)-21-cyano-2,12-diazahexacyclo[14.2.2.19,12.01,9.03,8.016,21]henicosa-3,5,7,17-tetraene-18,19-dicarboxylate |
|---|---|
| PubChem CID | 101165344 |
| Molecular Formula | C28H26N4O4S |
| Molecular Weight | 514.61 g/mol |
| Exact Mass | 514.17 |
| IUPAC Name | 18-O-methyl 19-O-(2-sulfanylidene-1-pyridinyl) (1S,9S,16R,21S)-21-cyano-2,12-diazahexacyclo[14.2.2.19,12.01,9.03,8.016,21]henicosa-3,5,7,17-tetraene-18,19-dicarboxylate |
| SMILES | COC(=O)C1=C[C@@]23CCCN4CC[C@@]5(c6ccccc6N[C@]15C(C(=O)On1ccccc1=S)C2)[C@@]43C#N |
| InChI | InChI=1S/C28H26N4O4S/c1-35-23(33)19-15-25-10-6-12-31-14-11-26(27(25,31)17-29)18-7-2-3-8-21(18)30-28(19,26)20(16-25)24(34)36-32-13-5-4-9-22(32)37/h2-5,7-9,13,15,20,30H,6,10-12,14,16H2,1H3/t20?,25-,26+,27-,28-/m0/s1 |
| InChIKey | ZEPFMPHXADADDP-AXCOEPQMSA-N |
| XLogP | 3.16 |
| TPSA | 96.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.61 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|