C13H18OSi — CID 101166327
(2S,6S,7R)-4-trimethylsilyltricyclo[5.2.1.02,6]deca-1(9),4-dien-3-one (PubChem CID 101166327) has the molecular formula C13H18OSi and a molecular weight of 218.37 g/mol. Its IUPAC name is (2S,6S,7R)-4-trimethylsilyltricyclo[5.2.1.02,6]deca-1(9),4-dien-3-one.
| Compound Name | (2S,6S,7R)-4-trimethylsilyltricyclo[5.2.1.02,6]deca-1(9),4-dien-3-one |
|---|---|
| PubChem CID | 101166327 |
| Molecular Formula | C13H18OSi |
| Molecular Weight | 218.37 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | (2S,6S,7R)-4-trimethylsilyltricyclo[5.2.1.02,6]deca-1(9),4-dien-3-one |
| SMILES | C[Si](C)(C)C1=C[C@H]2[C@@H]3CC=C(C3)[C@H]2C1=O |
| InChI | InChI=1S/C13H18OSi/c1-15(2,3)11-7-10-8-4-5-9(6-8)12(10)13(11)14/h5,7-8,10,12H,4,6H2,1-3H3/t8-,10+,12-/m1/s1 |
| InChIKey | XNEIEIBYKALKMP-UBHAPETDSA-N |
| XLogP | 2.96 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.37 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|