C19H28O3 — CID 70609815
5-(5-methyl-2-propan-2-ylcyclohexyl)oxy-4-oxatricyclo[5.2.1.02,6]dec-1(9)-en-3-one (PubChem CID 70609815) has the molecular formula C19H28O3 and a molecular weight of 304.43 g/mol. Its IUPAC name is 5-(5-methyl-2-propan-2-ylcyclohexyl)oxy-4-oxatricyclo[5.2.1.02,6]dec-1(9)-en-3-one.
| Compound Name | 5-(5-methyl-2-propan-2-ylcyclohexyl)oxy-4-oxatricyclo[5.2.1.02,6]dec-1(9)-en-3-one |
|---|---|
| PubChem CID | 70609815 |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | 5-(5-methyl-2-propan-2-ylcyclohexyl)oxy-4-oxatricyclo[5.2.1.02,6]dec-1(9)-en-3-one |
| SMILES | CC1CCC(C(C)C)C(OC2OC(=O)C3C4=CCC(C4)C23)C1 |
| InChI | InChI=1S/C19H28O3/c1-10(2)14-7-4-11(3)8-15(14)21-19-17-13-6-5-12(9-13)16(17)18(20)22-19/h5,10-11,13-17,19H,4,6-9H2,1-3H3 |
| InChIKey | FJBQBVXLXNEXQQ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|