C24H41NO3 — CID 10739223
(1S,2S,3R,6S,8S)-8,9,9-trimethyl-3-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-4-oxa-10-azatricyclo[8.3.0.02,6]tridecan-5-one (PubChem CID 10739223) has the molecular formula C24H41NO3 and a molecular weight of 391.60 g/mol. Its IUPAC name is (1S,2S,3R,6S,8S)-8,9,9-trimethyl-3-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-4-oxa-10-azatricyclo[8.3.0.02,6]tridecan-5-one.
| Compound Name | (1S,2S,3R,6S,8S)-8,9,9-trimethyl-3-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-4-oxa-10-azatricyclo[8.3.0.02,6]tridecan-5-one |
|---|---|
| PubChem CID | 10739223 |
| Molecular Formula | C24H41NO3 |
| Molecular Weight | 391.60 g/mol |
| Exact Mass | 391.31 |
| IUPAC Name | (1S,2S,3R,6S,8S)-8,9,9-trimethyl-3-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-4-oxa-10-azatricyclo[8.3.0.02,6]tridecan-5-one |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1O[C@@H]1OC(=O)[C@H]2C[C@H](C)C(C)(C)N3CCC[C@H]3[C@@H]12 |
| InChI | InChI=1S/C24H41NO3/c1-14(2)17-10-9-15(3)12-20(17)27-23-21-18(22(26)28-23)13-16(4)24(5,6)25-11-7-8-19(21)25/h14-21,23H,7-13H2,1-6H3/t15-,16+,17+,18+,19+,20-,21+,23-/m1/s1 |
| InChIKey | GYBWWWXZJXNMPV-HEMCLPRMSA-N |
| XLogP | 4.86 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.60 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |