C20H30O6 — CID 11024955
ethyl (3aR,4R,6aS)-2-methyl-4-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-6-oxo-4,6a-dihydro-3aH-furo[3,4-b]furan-3-carboxylate (PubChem CID 11024955) has the molecular formula C20H30O6 and a molecular weight of 366.45 g/mol. Its IUPAC name is ethyl (3aR,4R,6aS)-2-methyl-4-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-6-oxo-4,6a-dihydro-3aH-furo[3,4-b]furan-3-carboxylate.
| Compound Name | ethyl (3aR,4R,6aS)-2-methyl-4-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-6-oxo-4,6a-dihydro-3aH-furo[3,4-b]furan-3-carboxylate |
|---|---|
| PubChem CID | 11024955 |
| Molecular Formula | C20H30O6 |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | ethyl (3aR,4R,6aS)-2-methyl-4-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-6-oxo-4,6a-dihydro-3aH-furo[3,4-b]furan-3-carboxylate |
| SMILES | CCOC(=O)C1=C(C)O[C@@H]2C(=O)O[C@@H](O[C@@H]3C[C@H](C)CCC3C(C)C)[C@H]12 |
| InChI | InChI=1S/C20H30O6/c1-6-23-18(21)15-12(5)24-17-16(15)20(26-19(17)22)25-14-9-11(4)7-8-13(14)10(2)3/h10-11,13-14,16-17,20H,6-9H2,1-5H3/t11-,13?,14-,16-,17+,20-/m1/s1 |
| InChIKey | HWDBQSQQYZQYLE-HTRMYPNCSA-N |
| XLogP | 3.20 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |