C23H39NO3 — CID 10595771
(1R,2S,3R,6S)-9,9-dimethyl-3-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-4-oxa-10-azatricyclo[8.3.0.02,6]tridecan-5-one (PubChem CID 10595771) has the molecular formula C23H39NO3 and a molecular weight of 377.57 g/mol. Its IUPAC name is (1R,2S,3R,6S)-9,9-dimethyl-3-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-4-oxa-10-azatricyclo[8.3.0.02,6]tridecan-5-one.
| Compound Name | (1R,2S,3R,6S)-9,9-dimethyl-3-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-4-oxa-10-azatricyclo[8.3.0.02,6]tridecan-5-one |
|---|---|
| PubChem CID | 10595771 |
| Molecular Formula | C23H39NO3 |
| Molecular Weight | 377.57 g/mol |
| Exact Mass | 377.29 |
| IUPAC Name | (1R,2S,3R,6S)-9,9-dimethyl-3-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-4-oxa-10-azatricyclo[8.3.0.02,6]tridecan-5-one |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1O[C@@H]1OC(=O)[C@H]2CCC(C)(C)N3CCC[C@@H]3[C@@H]12 |
| InChI | InChI=1S/C23H39NO3/c1-14(2)16-9-8-15(3)13-19(16)26-22-20-17(21(25)27-22)10-11-23(4,5)24-12-6-7-18(20)24/h14-20,22H,6-13H2,1-5H3/t15-,16+,17+,18-,19-,20+,22-/m1/s1 |
| InChIKey | CZSMUQBUMROQCC-AYVVFJBBSA-N |
| XLogP | 4.62 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.57 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |