C23H32O3 — CID 59990981
(3S,3aS,9aR)-3a-methyl-3-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-3,4,9,9a-tetrahydrobenzo[f][2]benzofuran-1-one (PubChem CID 59990981) has the molecular formula C23H32O3 and a molecular weight of 356.51 g/mol. Its IUPAC name is (3S,3aS,9aR)-3a-methyl-3-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-3,4,9,9a-tetrahydrobenzo[f][2]benzofuran-1-one.
| Compound Name | (3S,3aS,9aR)-3a-methyl-3-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-3,4,9,9a-tetrahydrobenzo[f][2]benzofuran-1-one |
|---|---|
| PubChem CID | 59990981 |
| Molecular Formula | C23H32O3 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | (3S,3aS,9aR)-3a-methyl-3-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-3,4,9,9a-tetrahydrobenzo[f][2]benzofuran-1-one |
| SMILES | CC(C)C1CC[C@@H](C)CC1O[C@H]1OC(=O)[C@@H]2Cc3ccccc3C[C@]12C |
| InChI | InChI=1S/C23H32O3/c1-14(2)18-10-9-15(3)11-20(18)25-22-23(4)13-17-8-6-5-7-16(17)12-19(23)21(24)26-22/h5-8,14-15,18-20,22H,9-13H2,1-4H3/t15-,18?,19+,20?,22+,23+/m1/s1 |
| InChIKey | DJVPRDUAPZFCBX-KBWKWREDSA-N |
| XLogP | 4.77 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |