C25H32O5S — CID 11190009
(1R,2R,5R,6S,7S)-6-(benzenesulfonyl)-5-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-4-oxatricyclo[5.2.1.02,6]dec-8-en-3-one (PubChem CID 11190009) has the molecular formula C25H32O5S and a molecular weight of 444.59 g/mol. Its IUPAC name is (1R,2R,5R,6S,7S)-6-(benzenesulfonyl)-5-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-4-oxatricyclo[5.2.1.02,6]dec-8-en-3-one.
| Compound Name | (1R,2R,5R,6S,7S)-6-(benzenesulfonyl)-5-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-4-oxatricyclo[5.2.1.02,6]dec-8-en-3-one |
|---|---|
| PubChem CID | 11190009 |
| Molecular Formula | C25H32O5S |
| Molecular Weight | 444.59 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | (1R,2R,5R,6S,7S)-6-(benzenesulfonyl)-5-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-4-oxatricyclo[5.2.1.02,6]dec-8-en-3-one |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1O[C@@H]1OC(=O)[C@H]2[C@H]3C=C[C@H](C3)[C@@]12S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C25H32O5S/c1-15(2)20-12-9-16(3)13-21(20)29-24-25(31(27,28)19-7-5-4-6-8-19)18-11-10-17(14-18)22(25)23(26)30-24/h4-8,10-11,15-18,20-22,24H,9,12-14H2,1-3H3/t16-,17+,18-,20+,21-,22-,24-,25+/m1/s1 |
| InChIKey | NHWJUFUHGCDAKD-BHBWCDLJSA-N |
| XLogP | 4.38 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.59 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|