C22H28O4 — CID 15351549
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (1R,2R,7R,8S)-3,6-dioxotricyclo[6.2.1.02,7]undeca-4,9-diene-2-carboxylate (PubChem CID 15351549) has the molecular formula C22H28O4 and a molecular weight of 356.46 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (1R,2R,7R,8S)-3,6-dioxotricyclo[6.2.1.02,7]undeca-4,9-diene-2-carboxylate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (1R,2R,7R,8S)-3,6-dioxotricyclo[6.2.1.02,7]undeca-4,9-diene-2-carboxylate |
|---|---|
| PubChem CID | 15351549 |
| Molecular Formula | C22H28O4 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (1R,2R,7R,8S)-3,6-dioxotricyclo[6.2.1.02,7]undeca-4,9-diene-2-carboxylate |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1OC(=O)[C@@]12C(=O)C=CC(=O)[C@@H]1[C@@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C22H28O4/c1-12(2)16-7-4-13(3)10-18(16)26-21(25)22-15-6-5-14(11-15)20(22)17(23)8-9-19(22)24/h5-6,8-9,12-16,18,20H,4,7,10-11H2,1-3H3/t13-,14-,15+,16+,18-,20+,22+/m1/s1 |
| InChIKey | WQSAQWUEMJTWRB-WOGMDZAZSA-N |
| XLogP | 3.51 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|