C35H56O4 — CID 11295674
bis[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (1R,2S,3R,4S)-2-(4-methylpent-3-enyl)bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate (PubChem CID 11295674) has the molecular formula C35H56O4 and a molecular weight of 540.83 g/mol. Its IUPAC name is bis[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (1R,2S,3R,4S)-2-(4-methylpent-3-enyl)bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate.
| Compound Name | bis[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (1R,2S,3R,4S)-2-(4-methylpent-3-enyl)bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 11295674 |
| Molecular Formula | C35H56O4 |
| Molecular Weight | 540.83 g/mol |
| Exact Mass | 540.42 |
| IUPAC Name | bis[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (1R,2S,3R,4S)-2-(4-methylpent-3-enyl)bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
| SMILES | CC(C)=CCC[C@@]1(C(=O)O[C@@H]2C[C@H](C)CC[C@H]2C(C)C)[C@H](C(=O)O[C@@H]2C[C@H](C)CC[C@H]2C(C)C)[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C35H56O4/c1-21(2)10-9-17-35(34(37)39-31-19-25(8)12-16-29(31)23(5)6)27-14-13-26(20-27)32(35)33(36)38-30-18-24(7)11-15-28(30)22(3)4/h10,13-14,22-32H,9,11-12,15-20H2,1-8H3/t24-,25-,26-,27+,28+,29+,30-,31-,32+,35+/m1/s1 |
| InChIKey | CBKQJHBFYPQQBS-GBQQJKAYSA-N |
| XLogP | 8.55 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.83 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|