C29H46O4 — CID 102075959
bis[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate (PubChem CID 102075959) has the molecular formula C29H46O4 and a molecular weight of 458.68 g/mol. Its IUPAC name is bis[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate.
| Compound Name | bis[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 102075959 |
| Molecular Formula | C29H46O4 |
| Molecular Weight | 458.68 g/mol |
| Exact Mass | 458.34 |
| IUPAC Name | bis[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
| SMILES | CC(C)[C@H]1CC[C@H](C)C[C@@H]1OC(=O)C1C2C=CC(C2)C1C(=O)O[C@H]1C[C@@H](C)CC[C@@H]1C(C)C |
| InChI | InChI=1S/C29H46O4/c1-16(2)22-11-7-18(5)13-24(22)32-28(30)26-20-9-10-21(15-20)27(26)29(31)33-25-14-19(6)8-12-23(25)17(3)4/h9-10,16-27H,7-8,11-15H2,1-6H3/t18-,19-,20?,21?,22+,23+,24-,25-,26?,27?/m0/s1 |
| InChIKey | BVQYOJFRQWRPGV-DYKKEWGGSA-N |
| XLogP | 6.43 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.68 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|