C20H32O3 — CID 173150029
(5-methyl-2-propan-2-ylcyclohexyl) 2,2-dimethyl-3-(4-oxobut-1-enyl)cyclopropane-1-carboxylate (PubChem CID 173150029) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylcyclohexyl) 2,2-dimethyl-3-(4-oxobut-1-enyl)cyclopropane-1-carboxylate.
| Compound Name | (5-methyl-2-propan-2-ylcyclohexyl) 2,2-dimethyl-3-(4-oxobut-1-enyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 173150029 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl) 2,2-dimethyl-3-(4-oxobut-1-enyl)cyclopropane-1-carboxylate |
| SMILES | CC1CCC(C(C)C)C(OC(=O)C2C(C=CCC=O)C2(C)C)C1 |
| InChI | InChI=1S/C20H32O3/c1-13(2)15-10-9-14(3)12-17(15)23-19(22)18-16(20(18,4)5)8-6-7-11-21/h6,8,11,13-18H,7,9-10,12H2,1-5H3 |
| InChIKey | JGBBNNOTTYAIPM-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|