C30H48O4 — CID 10624289
[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] (1S,2R,3Z,4R)-3-[2-[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxy-2-oxoethylidene]bicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 10624289) has the molecular formula C30H48O4 and a molecular weight of 472.71 g/mol. Its IUPAC name is [(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] (1S,2R,3Z,4R)-3-[2-[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxy-2-oxoethylidene]bicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | [(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] (1S,2R,3Z,4R)-3-[2-[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxy-2-oxoethylidene]bicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 10624289 |
| Molecular Formula | C30H48O4 |
| Molecular Weight | 472.71 g/mol |
| Exact Mass | 472.36 |
| IUPAC Name | [(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] (1S,2R,3Z,4R)-3-[2-[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxy-2-oxoethylidene]bicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CC(C)[C@H]1CC[C@H](C)C[C@@H]1OC(=O)/C=C1/[C@@H]2CC[C@@H](C2)[C@H]1C(=O)O[C@H]1C[C@@H](C)CC[C@@H]1C(C)C |
| InChI | InChI=1S/C30H48O4/c1-17(2)23-11-7-19(5)13-26(23)33-28(31)16-25-21-9-10-22(15-21)29(25)30(32)34-27-14-20(6)8-12-24(27)18(3)4/h16-24,26-27,29H,7-15H2,1-6H3/b25-16-/t19-,20-,21+,22-,23+,24+,26-,27-,29+/m0/s1 |
| InChIKey | CXLMPYCHDRRLCX-RBMIYDBYSA-N |
| XLogP | 6.97 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.71 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|