C21H32O5 — CID 101079218
dimethyl (1S,2S,3R,4R)-2-[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxybicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate (PubChem CID 101079218) has the molecular formula C21H32O5 and a molecular weight of 364.48 g/mol. Its IUPAC name is dimethyl (1S,2S,3R,4R)-2-[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxybicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate.
| Compound Name | dimethyl (1S,2S,3R,4R)-2-[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxybicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 101079218 |
| Molecular Formula | C21H32O5 |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | dimethyl (1S,2S,3R,4R)-2-[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxybicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
| SMILES | COC(=O)[C@@H]1[C@H]2C=C[C@H](C2)[C@@]1(O[C@H]1C[C@@H](C)CC[C@@H]1C(C)C)C(=O)OC |
| InChI | InChI=1S/C21H32O5/c1-12(2)16-9-6-13(3)10-17(16)26-21(20(23)25-5)15-8-7-14(11-15)18(21)19(22)24-4/h7-8,12-18H,6,9-11H2,1-5H3/t13-,14-,15+,16+,17-,18-,21-/m0/s1 |
| InChIKey | BESSSIRHQFUCGL-ITXFDXOWSA-N |
| XLogP | 3.37 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|