C24H32O6 — CID 11761521
4a-O-methyl 1-O-(5-methyl-2-propan-2-ylcyclohexyl) (1R,4S,4aR,8aR)-4-methyl-5,8-dioxo-4,8a-dihydro-1H-naphthalene-1,4a-dicarboxylate (PubChem CID 11761521) has the molecular formula C24H32O6 and a molecular weight of 416.51 g/mol. Its IUPAC name is 4a-O-methyl 1-O-(5-methyl-2-propan-2-ylcyclohexyl) (1R,4S,4aR,8aR)-4-methyl-5,8-dioxo-4,8a-dihydro-1H-naphthalene-1,4a-dicarboxylate.
| Compound Name | 4a-O-methyl 1-O-(5-methyl-2-propan-2-ylcyclohexyl) (1R,4S,4aR,8aR)-4-methyl-5,8-dioxo-4,8a-dihydro-1H-naphthalene-1,4a-dicarboxylate |
|---|---|
| PubChem CID | 11761521 |
| Molecular Formula | C24H32O6 |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | 4a-O-methyl 1-O-(5-methyl-2-propan-2-ylcyclohexyl) (1R,4S,4aR,8aR)-4-methyl-5,8-dioxo-4,8a-dihydro-1H-naphthalene-1,4a-dicarboxylate |
| SMILES | COC(=O)[C@@]12C(=O)C=CC(=O)[C@@H]1[C@H](C(=O)OC1CC(C)CCC1C(C)C)C=C[C@@H]2C |
| InChI | InChI=1S/C24H32O6/c1-13(2)16-8-6-14(3)12-19(16)30-22(27)17-9-7-15(4)24(23(28)29-5)20(26)11-10-18(25)21(17)24/h7,9-11,13-17,19,21H,6,8,12H2,1-5H3/t14?,15-,16?,17+,19?,21-,24-/m0/s1 |
| InChIKey | QZCLPJRHSISXDJ-QUIRCYMMSA-N |
| XLogP | 3.30 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|