C18H28O4 — CID 24786679
cis-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (1R,2S)-2-methyl-4,6-dioxocyclohexane-1-carboxylate (PubChem CID 24786679) has the molecular formula C18H28O4 and a molecular weight of 308.42 g/mol. Its IUPAC name is cis-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (1R,2S)-2-methyl-4,6-dioxocyclohexane-1-carboxylate.
| Compound Name | cis-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (1R,2S)-2-methyl-4,6-dioxocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 24786679 |
| Molecular Formula | C18H28O4 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | cis-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (1R,2S)-2-methyl-4,6-dioxocyclohexane-1-carboxylate |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1OC(=O)[C@H]1C(=O)CC(=O)C[C@@H]1C |
| InChI | InChI=1S/C18H28O4/c1-10(2)14-6-5-11(3)7-16(14)22-18(21)17-12(4)8-13(19)9-15(17)20/h10-12,14,16-17H,5-9H2,1-4H3/t11-,12+,14+,16-,17-/m1/s1 |
| InChIKey | PRGRSARCPQJUKV-CASTZCHQSA-N |
| XLogP | 3.17 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|