C13H20OSi — CID 72789804
4-trimethylsilyltricyclo[5.2.1.02,6]dec-4-en-3-one (PubChem CID 72789804) has the molecular formula C13H20OSi and a molecular weight of 220.39 g/mol. Its IUPAC name is 4-trimethylsilyltricyclo[5.2.1.02,6]dec-4-en-3-one.
| Compound Name | 4-trimethylsilyltricyclo[5.2.1.02,6]dec-4-en-3-one |
|---|---|
| PubChem CID | 72789804 |
| Molecular Formula | C13H20OSi |
| Molecular Weight | 220.39 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 4-trimethylsilyltricyclo[5.2.1.02,6]dec-4-en-3-one |
| SMILES | C[Si](C)(C)C1=CC2C3CCC(C3)C2C1=O |
| InChI | InChI=1S/C13H20OSi/c1-15(2,3)11-7-10-8-4-5-9(6-8)12(10)13(11)14/h7-10,12H,4-6H2,1-3H3 |
| InChIKey | HDIXEHTYXAHQDD-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.39 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|