C24H32O8 — CID 101166468
tetraethyl (E)-dodec-6-en-1,11-diyne-3,3,8,8-tetracarboxylate (PubChem CID 101166468) has the molecular formula C24H32O8 and a molecular weight of 448.51 g/mol. Its IUPAC name is tetraethyl (E)-dodec-6-en-1,11-diyne-3,3,8,8-tetracarboxylate.
| Compound Name | tetraethyl (E)-dodec-6-en-1,11-diyne-3,3,8,8-tetracarboxylate |
|---|---|
| PubChem CID | 101166468 |
| Molecular Formula | C24H32O8 |
| Molecular Weight | 448.51 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | tetraethyl (E)-dodec-6-en-1,11-diyne-3,3,8,8-tetracarboxylate |
| SMILES | C#CCC(C/C=C/CC(CC#C)(C(=O)OCC)C(=O)OCC)(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C24H32O8/c1-7-15-23(19(25)29-9-3,20(26)30-10-4)17-13-14-18-24(16-8-2,21(27)31-11-5)22(28)32-12-6/h1-2,13-14H,9-12,15-18H2,3-6H3/b14-13+ |
| InChIKey | ZRMZLSQYURCONC-BUHFOSPRSA-N |
| XLogP | 2.59 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.51 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|