C12H22N2O6 — CID 101167528
(2S)-2-amino-6-[[(2S,3S)-2,3-dihydroxy-5,6-dioxo(113C)hexyl]amino]hexanoic acid (PubChem CID 101167528) has the molecular formula C12H22N2O6 and a molecular weight of 291.31 g/mol. Its IUPAC name is (2S)-2-amino-6-[[(2S,3S)-2,3-dihydroxy-5,6-dioxo(113C)hexyl]amino]hexanoic acid.
| Compound Name | (2S)-2-amino-6-[[(2S,3S)-2,3-dihydroxy-5,6-dioxo(113C)hexyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 101167528 |
| Molecular Formula | C12H22N2O6 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | (2S)-2-amino-6-[[(2S,3S)-2,3-dihydroxy-5,6-dioxo(113C)hexyl]amino]hexanoic acid |
| SMILES | N[C@@H](CCCCN[13CH2][C@H](O)[C@@H](O)CC(=O)C=O)C(=O)O |
| InChI | InChI=1S/C12H22N2O6/c13-9(12(19)20)3-1-2-4-14-6-11(18)10(17)5-8(16)7-15/h7,9-11,14,17-18H,1-6,13H2,(H,19,20)/t9-,10-,11-/m0/s1/i6+1 |
| InChIKey | FBRUDCITMBRCES-YJCGLIRNSA-N |
| XLogP | -1.96 |
| TPSA | 149.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|