C16H22N2O5 — CID 101167603
4-methoxy-1-[(2S,5S,9S)-9-(methoxymethoxy)-1-oxaspiro[4.4]non-3-en-2-yl]-5-methylpyrimidin-2-one (PubChem CID 101167603) has the molecular formula C16H22N2O5 and a molecular weight of 322.36 g/mol. Its IUPAC name is 4-methoxy-1-[(2S,5S,9S)-9-(methoxymethoxy)-1-oxaspiro[4.4]non-3-en-2-yl]-5-methylpyrimidin-2-one.
| Compound Name | 4-methoxy-1-[(2S,5S,9S)-9-(methoxymethoxy)-1-oxaspiro[4.4]non-3-en-2-yl]-5-methylpyrimidin-2-one |
|---|---|
| PubChem CID | 101167603 |
| Molecular Formula | C16H22N2O5 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 4-methoxy-1-[(2S,5S,9S)-9-(methoxymethoxy)-1-oxaspiro[4.4]non-3-en-2-yl]-5-methylpyrimidin-2-one |
| SMILES | COCO[C@H]1CCC[C@]12C=C[C@@H](n1cc(C)c(OC)nc1=O)O2 |
| InChI | InChI=1S/C16H22N2O5/c1-11-9-18(15(19)17-14(11)21-3)13-6-8-16(23-13)7-4-5-12(16)22-10-20-2/h6,8-9,12-13H,4-5,7,10H2,1-3H3/t12-,13-,16-/m0/s1 |
| InChIKey | DUMLPGHLNWGRFT-XEZPLFJOSA-N |
| XLogP | 1.56 |
| TPSA | 71.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|