C18H24O4S — CID 101167791
[(1S,5S)-4,8-dimethyl-4-(phenylsulfanylmethyl)-2,3-dioxabicyclo[3.3.1]nonan-8-yl] acetate (PubChem CID 101167791) has the molecular formula C18H24O4S and a molecular weight of 336.45 g/mol. Its IUPAC name is [(1S,5S)-4,8-dimethyl-4-(phenylsulfanylmethyl)-2,3-dioxabicyclo[3.3.1]nonan-8-yl] acetate.
| Compound Name | [(1S,5S)-4,8-dimethyl-4-(phenylsulfanylmethyl)-2,3-dioxabicyclo[3.3.1]nonan-8-yl] acetate |
|---|---|
| PubChem CID | 101167791 |
| Molecular Formula | C18H24O4S |
| Molecular Weight | 336.45 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | [(1S,5S)-4,8-dimethyl-4-(phenylsulfanylmethyl)-2,3-dioxabicyclo[3.3.1]nonan-8-yl] acetate |
| SMILES | CC(=O)OC1(C)CC[C@H]2C[C@@H]1OOC2(C)CSc1ccccc1 |
| InChI | InChI=1S/C18H24O4S/c1-13(19)20-17(2)10-9-14-11-16(17)21-22-18(14,3)12-23-15-7-5-4-6-8-15/h4-8,14,16H,9-12H2,1-3H3/t14-,16-,17?,18?/m0/s1 |
| InChIKey | JADTYIUPCUGISP-WSDZMALLSA-N |
| XLogP | 3.99 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.45 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|