C16H20O2S — CID 11119350
(1R,4S,5R)-4-methyl-8-methylidene-4-(phenylsulfanylmethyl)-2,3-dioxabicyclo[3.3.1]nonane (PubChem CID 11119350) has the molecular formula C16H20O2S and a molecular weight of 276.40 g/mol. Its IUPAC name is (1R,4S,5R)-4-methyl-8-methylidene-4-(phenylsulfanylmethyl)-2,3-dioxabicyclo[3.3.1]nonane.
| Compound Name | (1R,4S,5R)-4-methyl-8-methylidene-4-(phenylsulfanylmethyl)-2,3-dioxabicyclo[3.3.1]nonane |
|---|---|
| PubChem CID | 11119350 |
| Molecular Formula | C16H20O2S |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | (1R,4S,5R)-4-methyl-8-methylidene-4-(phenylsulfanylmethyl)-2,3-dioxabicyclo[3.3.1]nonane |
| SMILES | C=C1CC[C@@H]2C[C@H]1OO[C@]2(C)CSc1ccccc1 |
| InChI | InChI=1S/C16H20O2S/c1-12-8-9-13-10-15(12)17-18-16(13,2)11-19-14-6-4-3-5-7-14/h3-7,13,15H,1,8-11H2,2H3/t13-,15-,16-/m1/s1 |
| InChIKey | IRWKLFDMQNBBEZ-FVQBIDKESA-N |
| XLogP | 4.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|