C19H22O2S — CID 101123992
(2R,3R)-2-methyl-3-(2-phenylmethoxyethyl)-2-(phenylsulfanylmethyl)oxirane (PubChem CID 101123992) has the molecular formula C19H22O2S and a molecular weight of 314.45 g/mol. Its IUPAC name is (2R,3R)-2-methyl-3-(2-phenylmethoxyethyl)-2-(phenylsulfanylmethyl)oxirane.
| Compound Name | (2R,3R)-2-methyl-3-(2-phenylmethoxyethyl)-2-(phenylsulfanylmethyl)oxirane |
|---|---|
| PubChem CID | 101123992 |
| Molecular Formula | C19H22O2S |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | (2R,3R)-2-methyl-3-(2-phenylmethoxyethyl)-2-(phenylsulfanylmethyl)oxirane |
| SMILES | C[C@@]1(CSc2ccccc2)O[C@@H]1CCOCc1ccccc1 |
| InChI | InChI=1S/C19H22O2S/c1-19(15-22-17-10-6-3-7-11-17)18(21-19)12-13-20-14-16-8-4-2-5-9-16/h2-11,18H,12-15H2,1H3/t18-,19+/m1/s1 |
| InChIKey | WSSYFGXKHBNUTJ-MOPGFXCFSA-N |
| XLogP | 4.54 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|