C21H20N2 — CID 101168271
2,6-dimethyl-N-[4-[(E)-2-pyridin-3-ylethenyl]phenyl]aniline (PubChem CID 101168271) has the molecular formula C21H20N2 and a molecular weight of 300.40 g/mol. Its IUPAC name is 2,6-dimethyl-N-[4-[(E)-2-pyridin-3-ylethenyl]phenyl]aniline.
| Compound Name | 2,6-dimethyl-N-[4-[(E)-2-pyridin-3-ylethenyl]phenyl]aniline |
|---|---|
| PubChem CID | 101168271 |
| Molecular Formula | C21H20N2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 2,6-dimethyl-N-[4-[(E)-2-pyridin-3-ylethenyl]phenyl]aniline |
| SMILES | Cc1cccc(C)c1Nc1ccc(/C=C/c2cccnc2)cc1 |
| InChI | InChI=1S/C21H20N2/c1-16-5-3-6-17(2)21(16)23-20-12-10-18(11-13-20)8-9-19-7-4-14-22-15-19/h3-15,23H,1-2H3/b9-8+ |
| InChIKey | HOHSOPBABODVIY-CMDGGOBGSA-N |
| XLogP | 5.61 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |