C13H14O3 — CID 101168302
6-(4-methylphenyl)-4,6-dioxohexanal (PubChem CID 101168302) has the molecular formula C13H14O3 and a molecular weight of 218.25 g/mol. Its IUPAC name is 6-(4-methylphenyl)-4,6-dioxohexanal.
| Compound Name | 6-(4-methylphenyl)-4,6-dioxohexanal |
|---|---|
| PubChem CID | 101168302 |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 6-(4-methylphenyl)-4,6-dioxohexanal |
| SMILES | Cc1ccc(C(=O)CC(=O)CCC=O)cc1 |
| InChI | InChI=1S/C13H14O3/c1-10-4-6-11(7-5-10)13(16)9-12(15)3-2-8-14/h4-8H,2-3,9H2,1H3 |
| InChIKey | ZJAPLJHBPJBTNI-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|