C29H27F4NO4P2 — CID 101168361
N,N-bis[bis(5-fluoro-2-methoxyphenyl)phosphanyl]methanamine (PubChem CID 101168361) has the molecular formula C29H27F4NO4P2 and a molecular weight of 591.48 g/mol. Its IUPAC name is N,N-bis[bis(5-fluoro-2-methoxyphenyl)phosphanyl]methanamine.
| Compound Name | N,N-bis[bis(5-fluoro-2-methoxyphenyl)phosphanyl]methanamine |
|---|---|
| PubChem CID | 101168361 |
| Molecular Formula | C29H27F4NO4P2 |
| Molecular Weight | 591.48 g/mol |
| Exact Mass | 591.14 |
| IUPAC Name | N,N-bis[bis(5-fluoro-2-methoxyphenyl)phosphanyl]methanamine |
| SMILES | COc1ccc(F)cc1P(c1cc(F)ccc1OC)N(C)P(c1cc(F)ccc1OC)c1cc(F)ccc1OC |
| InChI | InChI=1S/C29H27F4NO4P2/c1-34(39(26-14-18(30)6-10-22(26)35-2)27-15-19(31)7-11-23(27)36-3)40(28-16-20(32)8-12-24(28)37-4)29-17-21(33)9-13-25(29)38-5/h6-17H,1-5H3 |
| InChIKey | OUOSCXLPCDIINV-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.48 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|