C9H12FNO2S — CID 143919772
5-fluoro-2-methoxy-N,N-dimethylbenzenesulfinamide (PubChem CID 143919772) has the molecular formula C9H12FNO2S and a molecular weight of 217.26 g/mol. Its IUPAC name is 5-fluoro-2-methoxy-N,N-dimethylbenzenesulfinamide.
| Compound Name | 5-fluoro-2-methoxy-N,N-dimethylbenzenesulfinamide |
|---|---|
| PubChem CID | 143919772 |
| Molecular Formula | C9H12FNO2S |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.06 |
| IUPAC Name | 5-fluoro-2-methoxy-N,N-dimethylbenzenesulfinamide |
| SMILES | COc1ccc(F)cc1S(=O)N(C)C |
| InChI | InChI=1S/C9H12FNO2S/c1-11(2)14(12)9-6-7(10)4-5-8(9)13-3/h4-6H,1-3H3 |
| InChIKey | SQIJXLZORSBBLB-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |