About anthracen-9-ylmethyl 2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl carbonate
anthracen-9-ylmethyl 2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl carbonate (PubChem CID 101168838) has the molecular formula C28H36O9
and a molecular weight of 516.59 g/mol. Its IUPAC name is anthracen-9-ylmethyl 2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl carbonate.
Molecular Properties
| Compound Name | anthracen-9-ylmethyl 2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl carbonate |
| PubChem CID | 101168838 |
| Molecular Formula | C28H36O9 |
| Molecular Weight | 516.59 g/mol |
| Exact Mass | 516.24 |
| IUPAC Name | anthracen-9-ylmethyl 2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl carbonate |
| SMILES | O=C(OCCOCCOCCOCCOCCOCCO)OCc1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C28H36O9/c29-9-10-31-11-12-32-13-14-33-15-16-34-17-18-35-19-20-36-28(30)37-22-27-25-7-3-1-5-23(25)21-24-6-2-4-8-26(24)27/h1-8,21,29H,9-20,22H2 |
| InChIKey | HVBNIUGKEGRBBF-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 516.59 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze anthracen-9-ylmethyl 2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anthracen-9-ylmethyl 2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl carbonate?
The IUPAC name of anthracen-9-ylmethyl 2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl carbonate (CID 101168838) is anthracen-9-ylmethyl 2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl carbonate.
What is the SMILES notation for anthracen-9-ylmethyl 2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl carbonate?
The canonical SMILES for anthracen-9-ylmethyl 2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl carbonate is O=C(OCCOCCOCCOCCOCCOCCO)OCc1c2ccccc2cc2ccccc12.
What is the InChIKey of anthracen-9-ylmethyl 2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl carbonate?
The InChIKey is HVBNIUGKEGRBBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H36O9/c29-9-10-31-11-12-32-13-14-33-15-16-34-17-18-35-19-20-36-28(30)37-22-27-25-7-3-1-5-23(25)21-24-6-2-4-8-26(24)27/h1-8,21,29H,9-20,22H2.
What are the key properties of anthracen-9-ylmethyl 2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl carbonate?
anthracen-9-ylmethyl 2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl carbonate has a molecular weight of 516.59 g/mol, XLogP of 3.72, 19 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for anthracen-9-ylmethyl 2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl carbonate is sourced from PubChem (CID 101168838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).