C14H24O3 — CID 101169641
methyl (2R,3S)-3-[2-(3,3-dimethyloxiran-2-yl)ethyl]-2,3-dimethylpent-4-enoate (PubChem CID 101169641) has the molecular formula C14H24O3 and a molecular weight of 240.34 g/mol. Its IUPAC name is methyl (2R,3S)-3-[2-(3,3-dimethyloxiran-2-yl)ethyl]-2,3-dimethylpent-4-enoate.
| Compound Name | methyl (2R,3S)-3-[2-(3,3-dimethyloxiran-2-yl)ethyl]-2,3-dimethylpent-4-enoate |
|---|---|
| PubChem CID | 101169641 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | methyl (2R,3S)-3-[2-(3,3-dimethyloxiran-2-yl)ethyl]-2,3-dimethylpent-4-enoate |
| SMILES | C=C[C@](C)(CCC1OC1(C)C)[C@@H](C)C(=O)OC |
| InChI | InChI=1S/C14H24O3/c1-7-14(5,10(2)12(15)16-6)9-8-11-13(3,4)17-11/h7,10-11H,1,8-9H2,2-6H3/t10-,11?,14+/m0/s1 |
| InChIKey | LYTSJKLSPHDUMM-PFSRQVJMSA-N |
| XLogP | 2.95 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|