C15H27NO2 — CID 10706063
methyl 2-(dimethylamino)-3-ethenyl-3,7-dimethyloct-6-enoate (PubChem CID 10706063) has the molecular formula C15H27NO2 and a molecular weight of 253.39 g/mol. Its IUPAC name is methyl 2-(dimethylamino)-3-ethenyl-3,7-dimethyloct-6-enoate.
| Compound Name | methyl 2-(dimethylamino)-3-ethenyl-3,7-dimethyloct-6-enoate |
|---|---|
| PubChem CID | 10706063 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | methyl 2-(dimethylamino)-3-ethenyl-3,7-dimethyloct-6-enoate |
| SMILES | C=CC(C)(CCC=C(C)C)C(C(=O)OC)N(C)C |
| InChI | InChI=1S/C15H27NO2/c1-8-15(4,11-9-10-12(2)3)13(16(5)6)14(17)18-7/h8,10,13H,1,9,11H2,2-7H3 |
| InChIKey | QREBMBCMMPXTKK-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|