C42H75BO3 — CID 88759043
tris(5-ethenyl-5,9-dimethyldec-8-en-4-yl) borate (PubChem CID 88759043) has the molecular formula C42H75BO3 and a molecular weight of 638.87 g/mol. Its IUPAC name is tris(5-ethenyl-5,9-dimethyldec-8-en-4-yl) borate.
| Compound Name | tris(5-ethenyl-5,9-dimethyldec-8-en-4-yl) borate |
|---|---|
| PubChem CID | 88759043 |
| Molecular Formula | C42H75BO3 |
| Molecular Weight | 638.87 g/mol |
| Exact Mass | 638.58 |
| IUPAC Name | tris(5-ethenyl-5,9-dimethyldec-8-en-4-yl) borate |
| SMILES | C=CC(C)(CCC=C(C)C)C(CCC)OB(OC(CCC)C(C)(C=C)CCC=C(C)C)OC(CCC)C(C)(C=C)CCC=C(C)C |
| InChI | InChI=1S/C42H75BO3/c1-16-25-37(40(13,19-4)31-22-28-34(7)8)44-43(45-38(26-17-2)41(14,20-5)32-23-29-35(9)10)46-39(27-18-3)42(15,21-6)33-24-30-36(11)12/h19-21,28-30,37-39H,4-6,16-18,22-27,31-33H2,1-3,7-15H3 |
| InChIKey | OLTOKNODMRSLNN-UHFFFAOYSA-N |
| XLogP | 13.34 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.87 |
| LogP ≤ 5 | 13.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|