C14H24O — CID 101171000
(2R,3S,6S)-3-butyl-2-ethenyl-2,6-dimethylcyclohexan-1-one (PubChem CID 101171000) has the molecular formula C14H24O and a molecular weight of 208.34 g/mol. Its IUPAC name is (2R,3S,6S)-3-butyl-2-ethenyl-2,6-dimethylcyclohexan-1-one.
| Compound Name | (2R,3S,6S)-3-butyl-2-ethenyl-2,6-dimethylcyclohexan-1-one |
|---|---|
| PubChem CID | 101171000 |
| Molecular Formula | C14H24O |
| Molecular Weight | 208.34 g/mol |
| Exact Mass | 208.18 |
| IUPAC Name | (2R,3S,6S)-3-butyl-2-ethenyl-2,6-dimethylcyclohexan-1-one |
| SMILES | C=C[C@@]1(C)C(=O)[C@@H](C)CC[C@@H]1CCCC |
| InChI | InChI=1S/C14H24O/c1-5-7-8-12-10-9-11(3)13(15)14(12,4)6-2/h6,11-12H,2,5,7-10H2,1,3-4H3/t11-,12-,14+/m0/s1 |
| InChIKey | GZUIQDQGBZHNAC-SGMGOOAPSA-N |
| XLogP | 3.98 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.34 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|