C12H20O — CID 134919205
cis-(2R,3S)-2-ethenyl-2-methyl-3-pentylcyclobutan-1-one (PubChem CID 134919205) has the molecular formula C12H20O and a molecular weight of 180.29 g/mol. Its IUPAC name is cis-(2R,3S)-2-ethenyl-2-methyl-3-pentylcyclobutan-1-one.
| Compound Name | cis-(2R,3S)-2-ethenyl-2-methyl-3-pentylcyclobutan-1-one |
|---|---|
| PubChem CID | 134919205 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | cis-(2R,3S)-2-ethenyl-2-methyl-3-pentylcyclobutan-1-one |
| SMILES | C=C[C@@]1(C)C(=O)C[C@@H]1CCCCC |
| InChI | InChI=1S/C12H20O/c1-4-6-7-8-10-9-11(13)12(10,3)5-2/h5,10H,2,4,6-9H2,1,3H3/t10-,12+/m0/s1 |
| InChIKey | NJDFTXQKBBFAQY-CMPLNLGQSA-N |
| XLogP | 3.35 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|